C20H20F6O6S2 — CID 14506823
[(8R,9S,13S,14S)-13-methyl-3-(trifluoromethylsulfonyloxy)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 14506823) has the molecular formula C20H20F6O6S2 and a molecular weight of 534.50 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-3-(trifluoromethylsulfonyloxy)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-3-(trifluoromethylsulfonyloxy)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14506823 |
| Molecular Formula | C20H20F6O6S2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-3-(trifluoromethylsulfonyloxy)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OS(=O)(=O)C(F)(F)F)cc4CC[C@H]3[C@@H]1CC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H20F6O6S2/c1-18-9-8-14-13-5-3-12(31-33(27,28)19(21,22)23)10-11(13)2-4-15(14)16(18)6-7-17(18)32-34(29,30)20(24,25)26/h3,5,7,10,14-16H,2,4,6,8-9H2,1H3/t14-,15-,16+,18+/m1/s1 |
| InChIKey | WSVGDGBTRCOTKL-CBZIJGRNSA-N |
| XLogP | 5.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|