C16H18F6O3S — CID 10501390
[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 10501390) has the molecular formula C16H18F6O3S and a molecular weight of 404.37 g/mol. Its IUPAC name is [5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10501390 |
| Molecular Formula | C16H18F6O3S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H18F6O3S/c1-13(2)5-6-14(3,4)10-8-12(25-26(23,24)16(20,21)22)11(7-9(10)13)15(17,18)19/h7-8H,5-6H2,1-4H3 |
| InChIKey | CFJPEPMPQCKBCF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|