C15H18F3IO3S — CID 10766458
(3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 10766458) has the molecular formula C15H18F3IO3S and a molecular weight of 462.27 g/mol. Its IUPAC name is (3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10766458 |
| Molecular Formula | C15H18F3IO3S |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | (3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)CCC(C)(C)c2cc(OS(=O)(=O)C(F)(F)F)c(I)cc21 |
| InChI | InChI=1S/C15H18F3IO3S/c1-13(2)5-6-14(3,4)10-8-12(11(19)7-9(10)13)22-23(20,21)15(16,17)18/h7-8H,5-6H2,1-4H3 |
| InChIKey | QPASYHRRUFNJTC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|