C14H19F3O3SSi — CID 11703091
(3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 11703091) has the molecular formula C14H19F3O3SSi and a molecular weight of 352.45 g/mol. Its IUPAC name is (3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11703091 |
| Molecular Formula | C14H19F3O3SSi |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc2c(cc1OS(=O)(=O)C(F)(F)F)CCCC2 |
| InChI | InChI=1S/C14H19F3O3SSi/c1-22(2,3)13-9-11-7-5-4-6-10(11)8-12(13)20-21(18,19)14(15,16)17/h8-9H,4-7H2,1-3H3 |
| InChIKey | LJXKNFRZFYVVHD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|