C34H37F3O7SSi — CID 24874028
[7-acetyl-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 24874028) has the molecular formula C34H37F3O7SSi and a molecular weight of 674.81 g/mol. Its IUPAC name is [7-acetyl-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-acetyl-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24874028 |
| Molecular Formula | C34H37F3O7SSi |
| Molecular Weight | 674.81 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | [7-acetyl-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | COc1c(C[C@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(C(C)=O)c(OC)c2cc(OS(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C34H37F3O7SSi/c1-22(44-46(33(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26)20-29-30(23(2)38)32(42-7)28-21-24(18-19-27(28)31(29)41-6)43-45(39,40)34(35,36)37/h8-19,21-22H,20H2,1-7H3/t22-/m0/s1 |
| InChIKey | XQSHGNGERBUXON-QFIPXVFZSA-N |
| XLogP | 6.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.81 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|