C49H78N4O12 — CID 58831481
N,N'-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N,N'-bis[2-oxo-2-(3-phenylpropylamino)ethyl]-2-pent-4-enylbutanediamide (PubChem CID 58831481) has the molecular formula C49H78N4O12 and a molecular weight of 915.18 g/mol. Its IUPAC name is N,N'-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N,N'-bis[2-oxo-2-(3-phenylpropylamino)ethyl]-2-pent-4-enylbutanediamide.
| Compound Name | N,N'-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N,N'-bis[2-oxo-2-(3-phenylpropylamino)ethyl]-2-pent-4-enylbutanediamide |
|---|---|
| PubChem CID | 58831481 |
| Molecular Formula | C49H78N4O12 |
| Molecular Weight | 915.18 g/mol |
| Exact Mass | 914.56 |
| IUPAC Name | N,N'-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N,N'-bis[2-oxo-2-(3-phenylpropylamino)ethyl]-2-pent-4-enylbutanediamide |
| SMILES | C=CCCCC(CC(=O)N(CCOCCOCCOCCOC)CC(=O)NCCCc1ccccc1)C(=O)N(CCOCCOCCOCCOC)CC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C49H78N4O12/c1-4-5-8-21-45(49(57)53(25-27-61-33-35-65-39-37-63-31-29-59-3)42-47(55)51-23-14-20-44-17-11-7-12-18-44)40-48(56)52(24-26-60-32-34-64-38-36-62-30-28-58-2)41-46(54)50-22-13-19-43-15-9-6-10-16-43/h4,6-7,9-12,15-18,45H,1,5,8,13-14,19-42H2,2-3H3,(H,50,54)(H,51,55) |
| InChIKey | BOODRUWUGIRVKH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 172.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|