C48H57N7O7 — CID 10533552
N,N-bis[2-[[2-(benzylamino)-2-oxoethyl]-[2-oxo-2-(2-phenylethylamino)ethyl]amino]-2-oxoethyl]hex-5-enamide (PubChem CID 10533552) has the molecular formula C48H57N7O7 and a molecular weight of 844.03 g/mol. Its IUPAC name is N,N-bis[2-[[2-(benzylamino)-2-oxoethyl]-[2-oxo-2-(2-phenylethylamino)ethyl]amino]-2-oxoethyl]hex-5-enamide.
| Compound Name | N,N-bis[2-[[2-(benzylamino)-2-oxoethyl]-[2-oxo-2-(2-phenylethylamino)ethyl]amino]-2-oxoethyl]hex-5-enamide |
|---|---|
| PubChem CID | 10533552 |
| Molecular Formula | C48H57N7O7 |
| Molecular Weight | 844.03 g/mol |
| Exact Mass | 843.43 |
| IUPAC Name | N,N-bis[2-[[2-(benzylamino)-2-oxoethyl]-[2-oxo-2-(2-phenylethylamino)ethyl]amino]-2-oxoethyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)N(CC(=O)N(CC(=O)NCCc1ccccc1)CC(=O)NCc1ccccc1)CC(=O)N(CC(=O)NCCc1ccccc1)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C48H57N7O7/c1-2-3-8-25-46(60)55(36-47(61)53(34-44(58)51-30-40-21-13-6-14-22-40)32-42(56)49-28-26-38-17-9-4-10-18-38)37-48(62)54(35-45(59)52-31-41-23-15-7-16-24-41)33-43(57)50-29-27-39-19-11-5-12-20-39/h2,4-7,9-24H,1,3,8,25-37H2,(H,49,56)(H,50,57)(H,51,58)(H,52,59) |
| InChIKey | DZBAOQMYGGARPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 62 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.03 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|