C25H34N4O4 — CID 143059146
N-(2-anilino-2-oxoethyl)-7-(hydroxyamino)-N-[2-oxo-2-(2-phenylethylamino)ethyl]heptanamide (PubChem CID 143059146) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-7-(hydroxyamino)-N-[2-oxo-2-(2-phenylethylamino)ethyl]heptanamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-7-(hydroxyamino)-N-[2-oxo-2-(2-phenylethylamino)ethyl]heptanamide |
|---|---|
| PubChem CID | 143059146 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-7-(hydroxyamino)-N-[2-oxo-2-(2-phenylethylamino)ethyl]heptanamide |
| SMILES | O=C(CN(CC(=O)Nc1ccccc1)C(=O)CCCCCCNO)NCCc1ccccc1 |
| InChI | InChI=1S/C25H34N4O4/c30-23(26-18-16-21-11-5-3-6-12-21)19-29(25(32)15-9-1-2-10-17-27-33)20-24(31)28-22-13-7-4-8-14-22/h3-8,11-14,27,33H,1-2,9-10,15-20H2,(H,26,30)(H,28,31) |
| InChIKey | WWSQQEVLPDROHA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|