C21H32N2O2 — CID 102203666
N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]-N-methyldec-9-enamide (PubChem CID 102203666) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]-N-methyldec-9-enamide.
| Compound Name | N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]-N-methyldec-9-enamide |
|---|---|
| PubChem CID | 102203666 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]-N-methyldec-9-enamide |
| SMILES | C=CCCCCCCCC(=O)N(C)[C@@H](C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O2/c1-4-5-6-7-8-9-13-16-20(24)23(3)18(2)21(25)22-17-19-14-11-10-12-15-19/h4,10-12,14-15,18H,1,5-9,13,16-17H2,2-3H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | SZOXLBZXGALTON-SFHVURJKSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|