C20H29NO3 — CID 132528630
(2S)-2-[dec-9-enoyl(methyl)amino]-3-phenylpropanoic acid (PubChem CID 132528630) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2S)-2-[dec-9-enoyl(methyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[dec-9-enoyl(methyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 132528630 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2S)-2-[dec-9-enoyl(methyl)amino]-3-phenylpropanoic acid |
| SMILES | C=CCCCCCCCC(=O)N(C)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H29NO3/c1-3-4-5-6-7-8-12-15-19(22)21(2)18(20(23)24)16-17-13-10-9-11-14-17/h3,9-11,13-14,18H,1,4-8,12,15-16H2,2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | OONANLVMWCIMGL-SFHVURJKSA-N |
| XLogP | 4.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|