C6H6O4 — CID 588355
benzene-1,2,3,4-tetrol (PubChem CID 588355) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is benzene-1,2,3,4-tetrol.
| Compound Name | benzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 588355 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | benzene-1,2,3,4-tetrol |
| SMILES | Oc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C6H6O4/c7-3-1-2-4(8)6(10)5(3)9/h1-2,7-10H |
| InChIKey | VERMEZLHWFHDLK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|