C24H27N3O2 — CID 58837389
1'-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-6'-isocyanospiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 58837389) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1'-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-6'-isocyanospiro[cyclohexane-1,3'-indole]-2'-one.
| Compound Name | 1'-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-6'-isocyanospiro[cyclohexane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 58837389 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1'-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-6'-isocyanospiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(C(c1ccccc1)[C@H](O)CNC)C(=O)C21CCCCC1 |
| InChI | InChI=1S/C24H27N3O2/c1-25-16-21(28)22(17-9-5-3-6-10-17)27-20-15-18(26-2)11-12-19(20)24(23(27)29)13-7-4-8-14-24/h3,5-6,9-12,15,21-22,25,28H,4,7-8,13-14,16H2,1H3/t21-,22?/m1/s1 |
| InChIKey | CBGGJVLUJRQMNG-ZMFCMNQTSA-N |
| XLogP | 4.11 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|