C25H32ClFN2O2 — CID 69459311
6'-fluoro-1'-[(1S,2R)-2-hydroxy-1-phenyl-3-(propylamino)propyl]spiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride (PubChem CID 69459311) has the molecular formula C25H32ClFN2O2 and a molecular weight of 446.99 g/mol. Its IUPAC name is 6'-fluoro-1'-[(1S,2R)-2-hydroxy-1-phenyl-3-(propylamino)propyl]spiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride.
| Compound Name | 6'-fluoro-1'-[(1S,2R)-2-hydroxy-1-phenyl-3-(propylamino)propyl]spiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride |
|---|---|
| PubChem CID | 69459311 |
| Molecular Formula | C25H32ClFN2O2 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 6'-fluoro-1'-[(1S,2R)-2-hydroxy-1-phenyl-3-(propylamino)propyl]spiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride |
| SMILES | CCCNC[C@@H](O)[C@H](c1ccccc1)N1C(=O)C2(CCCCC2)c2ccc(F)cc21.Cl |
| InChI | InChI=1S/C25H31FN2O2.ClH/c1-2-15-27-17-22(29)23(18-9-5-3-6-10-18)28-21-16-19(26)11-12-20(21)25(24(28)30)13-7-4-8-14-25;/h3,5-6,9-12,16,22-23,27,29H,2,4,7-8,13-15,17H2,1H3;1H/t22-,23+;/m1./s1 |
| InChIKey | VIDWZFCPGRHIIO-RFPXDPOKSA-N |
| XLogP | 4.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|