C29H18N6O2 — CID 58838930
5-(1-benzofuran-2-carbonyl)-4-isocyano-3-phenyl-2-(5-phenyl-1H-pyrazol-3-yl)-3H-pyrazole-4-carbonitrile (PubChem CID 58838930) has the molecular formula C29H18N6O2 and a molecular weight of 482.50 g/mol. Its IUPAC name is 5-(1-benzofuran-2-carbonyl)-4-isocyano-3-phenyl-2-(5-phenyl-1H-pyrazol-3-yl)-3H-pyrazole-4-carbonitrile.
| Compound Name | 5-(1-benzofuran-2-carbonyl)-4-isocyano-3-phenyl-2-(5-phenyl-1H-pyrazol-3-yl)-3H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 58838930 |
| Molecular Formula | C29H18N6O2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 5-(1-benzofuran-2-carbonyl)-4-isocyano-3-phenyl-2-(5-phenyl-1H-pyrazol-3-yl)-3H-pyrazole-4-carbonitrile |
| SMILES | [C-]#[N+]C1(C#N)C(C(=O)c2cc3ccccc3o2)=NN(c2cc(-c3ccccc3)[nH]n2)C1c1ccccc1 |
| InChI | InChI=1S/C29H18N6O2/c1-31-29(18-30)27(26(36)24-16-21-14-8-9-15-23(21)37-24)34-35(28(29)20-12-6-3-7-13-20)25-17-22(32-33-25)19-10-4-2-5-11-19/h2-17,28H,(H,32,33) |
| InChIKey | GJWMUKIISBCXKD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|