C9H16O4S — CID 58840844
(1S)-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)ethane-1,2-diol (PubChem CID 58840844) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (1S)-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)ethane-1,2-diol.
| Compound Name | (1S)-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 58840844 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (1S)-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)ethane-1,2-diol |
| SMILES | CC1(C)OC2CSC([C@@H](O)CO)C2O1 |
| InChI | InChI=1S/C9H16O4S/c1-9(2)12-6-4-14-8(5(11)3-10)7(6)13-9/h5-8,10-11H,3-4H2,1-2H3/t5-,6?,7?,8?/m0/s1 |
| InChIKey | YSGGUGVSXFYQDO-MBNAKOSBSA-N |
| XLogP | -0.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |