C12H22NO7P — CID 58841977
4-oxo-4-[2-[prop-2-enoxy(propoxy)phosphoryl]oxyethylamino]butanoic acid (PubChem CID 58841977) has the molecular formula C12H22NO7P and a molecular weight of 323.28 g/mol. Its IUPAC name is 4-oxo-4-[2-[prop-2-enoxy(propoxy)phosphoryl]oxyethylamino]butanoic acid.
| Compound Name | 4-oxo-4-[2-[prop-2-enoxy(propoxy)phosphoryl]oxyethylamino]butanoic acid |
|---|---|
| PubChem CID | 58841977 |
| Molecular Formula | C12H22NO7P |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-oxo-4-[2-[prop-2-enoxy(propoxy)phosphoryl]oxyethylamino]butanoic acid |
| SMILES | C=CCOP(=O)(OCCC)OCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H22NO7P/c1-3-8-18-21(17,19-9-4-2)20-10-7-13-11(14)5-6-12(15)16/h3H,1,4-10H2,2H3,(H,13,14)(H,15,16) |
| InChIKey | HQSXIGKILYCNKO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|