C30H36N4O3 — CID 58843179
4-[(4-phenoxyphenyl)carbamoylamino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide (PubChem CID 58843179) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[(4-phenoxyphenyl)carbamoylamino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide.
| Compound Name | 4-[(4-phenoxyphenyl)carbamoylamino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide |
|---|---|
| PubChem CID | 58843179 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 4-[(4-phenoxyphenyl)carbamoylamino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide |
| SMILES | O=C(CCC(Cc1ccccc1)NC(=O)Nc1ccc(Oc2ccccc2)cc1)NCCN1CCCC1 |
| InChI | InChI=1S/C30H36N4O3/c35-29(31-19-22-34-20-7-8-21-34)18-15-26(23-24-9-3-1-4-10-24)33-30(36)32-25-13-16-28(17-14-25)37-27-11-5-2-6-12-27/h1-6,9-14,16-17,26H,7-8,15,18-23H2,(H,31,35)(H2,32,33,36) |
| InChIKey | NCJXHPLCQQSPHT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |