C46H32CuN4O4 — CID 58843816
copper;4,7-diphenyl-1,10-phenanthroline;methyl 2-(4-methoxycarbonylquinolin-2-yl)quinoline-4-carboxylate (PubChem CID 58843816) has the molecular formula C46H32CuN4O4 and a molecular weight of 768.33 g/mol. Its IUPAC name is copper;4,7-diphenyl-1,10-phenanthroline;methyl 2-(4-methoxycarbonylquinolin-2-yl)quinoline-4-carboxylate.
| Compound Name | copper;4,7-diphenyl-1,10-phenanthroline;methyl 2-(4-methoxycarbonylquinolin-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 58843816 |
| Molecular Formula | C46H32CuN4O4 |
| Molecular Weight | 768.33 g/mol |
| Exact Mass | 767.17 |
| IUPAC Name | copper;4,7-diphenyl-1,10-phenanthroline;methyl 2-(4-methoxycarbonylquinolin-2-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(C(=O)OC)c3ccccc3n2)nc2ccccc12.[Cu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C22H16N2O4.Cu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;1-27-21(25)15-11-19(23-17-9-5-3-7-13(15)17)20-12-16(22(26)28-2)14-8-4-6-10-18(14)24-20;/h1-16H;3-12H,1-2H3; |
| InChIKey | ZKEWKAYAKYRIBS-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.33 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|