C16H15NOS — CID 58843841
(3S,4S)-1-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one (PubChem CID 58843841) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is (3S,4S)-1-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one.
| Compound Name | (3S,4S)-1-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 58843841 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (3S,4S)-1-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
| SMILES | CN1C(=O)[C@@H](Sc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15NOS/c1-17-14(12-8-4-2-5-9-12)15(16(17)18)19-13-10-6-3-7-11-13/h2-11,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | FARPHKSGUFBYIM-GJZGRUSLSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |