C13H11FN2O4 — CID 58844109
methyl 4-[(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl]benzoate (PubChem CID 58844109) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is methyl 4-[(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl]benzoate.
| Compound Name | methyl 4-[(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 58844109 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 4-[(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2c(=O)[nH]cc(F)c2=O)cc1 |
| InChI | InChI=1S/C13H11FN2O4/c1-20-12(18)9-4-2-8(3-5-9)7-16-11(17)10(14)6-15-13(16)19/h2-6H,7H2,1H3,(H,15,19) |
| InChIKey | PXQCRDZKSWGUMX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |