C40H33N2O9P — CID 58844387
[2-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-2-[2-(3-hydroxyphenyl)-2-oxoethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetyl] 4-nitrobenzoate (PubChem CID 58844387) has the molecular formula C40H33N2O9P and a molecular weight of 716.68 g/mol. Its IUPAC name is [2-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-2-[2-(3-hydroxyphenyl)-2-oxoethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetyl] 4-nitrobenzoate.
| Compound Name | [2-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-2-[2-(3-hydroxyphenyl)-2-oxoethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 58844387 |
| Molecular Formula | C40H33N2O9P |
| Molecular Weight | 716.68 g/mol |
| Exact Mass | 716.19 |
| IUPAC Name | [2-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-2-[2-(3-hydroxyphenyl)-2-oxoethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetyl] 4-nitrobenzoate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N(C(C(=O)OC(=O)c2ccc([N+](=O)[O-])cc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1CC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C40H33N2O9P/c1-26(43)36-34(25-35(45)28-12-11-13-30(44)24-28)41(37(36)46)38(40(48)51-39(47)27-20-22-29(23-21-27)42(49)50)52(31-14-5-2-6-15-31,32-16-7-3-8-17-32)33-18-9-4-10-19-33/h2-24,26,34,36,43-44H,25H2,1H3/t26-,34-,36-/m1/s1 |
| InChIKey | FYHVELORXZQYKW-RXIRESSYSA-N |
| XLogP | 4.59 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|