C23H19F6N5O4S — CID 58845105
2-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 58845105) has the molecular formula C23H19F6N5O4S and a molecular weight of 575.49 g/mol. Its IUPAC name is 2-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58845105 |
| Molecular Formula | C23H19F6N5O4S |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | 2-[4-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(S(=O)(=O)c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H19F6N5O4S/c24-22(25,26)17-9-15(10-18(11-17)23(27,28)29)14-1-3-19(4-2-14)39(37,38)34-7-5-33(6-8-34)21-30-12-16(13-31-21)20(35)32-36/h1-4,9-13,36H,5-8H2,(H,32,35) |
| InChIKey | SSBPKYJSFUHEJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|