C9H17NO3S — CID 58845601
1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutan-1-one (PubChem CID 58845601) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutan-1-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 58845601 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H17NO3S/c1-8(2)7-9(11)10-3-5-14(12,13)6-4-10/h8H,3-7H2,1-2H3 |
| InChIKey | ITLKCVJJGCKPFJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |