C16H26N2O4S4 — CID 58846476
2-[4-(2-carboxybutan-2-ylsulfanylcarbothioyl)piperazine-1-carbothioyl]sulfanyl-2-methylbutanoic acid (PubChem CID 58846476) has the molecular formula C16H26N2O4S4 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-[4-(2-carboxybutan-2-ylsulfanylcarbothioyl)piperazine-1-carbothioyl]sulfanyl-2-methylbutanoic acid.
| Compound Name | 2-[4-(2-carboxybutan-2-ylsulfanylcarbothioyl)piperazine-1-carbothioyl]sulfanyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 58846476 |
| Molecular Formula | C16H26N2O4S4 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[4-(2-carboxybutan-2-ylsulfanylcarbothioyl)piperazine-1-carbothioyl]sulfanyl-2-methylbutanoic acid |
| SMILES | CCC(C)(SC(=S)N1CCN(C(=S)SC(C)(CC)C(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C16H26N2O4S4/c1-5-15(3,11(19)20)25-13(23)17-7-9-18(10-8-17)14(24)26-16(4,6-2)12(21)22/h5-10H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | ODMXSIVQTCJECN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|