C8H11F3O3S2 — CID 87082113
2-methyl-2-(1,2,2-trifluoroethoxycarbothioylsulfanyl)butanoic acid (PubChem CID 87082113) has the molecular formula C8H11F3O3S2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-methyl-2-(1,2,2-trifluoroethoxycarbothioylsulfanyl)butanoic acid.
| Compound Name | 2-methyl-2-(1,2,2-trifluoroethoxycarbothioylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 87082113 |
| Molecular Formula | C8H11F3O3S2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-methyl-2-(1,2,2-trifluoroethoxycarbothioylsulfanyl)butanoic acid |
| SMILES | CCC(C)(SC(=S)OC(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C8H11F3O3S2/c1-3-8(2,6(12)13)16-7(15)14-5(11)4(9)10/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | VLAXIQJBWQWFRN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|