C31H42N3O7+ — CID 58848751
(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]pyrrolidine-3-carboxylic acid (PubChem CID 58848751) has the molecular formula C31H42N3O7+ and a molecular weight of 568.69 g/mol. Its IUPAC name is (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58848751 |
| Molecular Formula | C31H42N3O7+ |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C1OCCO1)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C31H41N3O7/c1-5-6-12-34(22-8-7-11-32(4)17-22)27(35)19-33-18-23(21-9-10-25-26(15-21)41-20-40-25)28(29(36)37)24(33)16-31(2,3)30-38-13-14-39-30/h7-11,15,17,23-24,28,30H,5-6,12-14,16,18-20H2,1-4H3/p+1/t23-,24+,28-/m1/s1 |
| InChIKey | RTMRUSGIGOBQCI-FMGHJNRGSA-O |
| XLogP | 3.33 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|