C32H46N3O6+ — CID 58848980
(2S,3R,4S)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-(2,2-dimethylpentyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 58848980) has the molecular formula C32H46N3O6+ and a molecular weight of 568.74 g/mol. Its IUPAC name is (2S,3R,4S)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-(2,2-dimethylpentyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-(2,2-dimethylpentyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58848980 |
| Molecular Formula | C32H46N3O6+ |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | (2S,3R,4S)-1-[2-[butyl-(1-methylpyridin-1-ium-3-yl)amino]-2-oxoethyl]-2-(2,2-dimethylpentyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C32H45N3O6/c1-7-9-14-35(23-11-10-13-33(5)18-23)28(36)20-34-19-24(22-15-26(39-6)30-27(16-22)40-21-41-30)29(31(37)38)25(34)17-32(3,4)12-8-2/h10-11,13,15-16,18,24-25,29H,7-9,12,14,17,19-21H2,1-6H3/p+1/t24-,25+,29-/m1/s1 |
| InChIKey | FSKROGGJLUVLKY-BEYSDYMESA-O |
| XLogP | 4.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|