C28H43N3O4S — CID 58850124
[(2R,6R)-1-(benzenesulfonyl)-6-methylpiperidin-2-yl]methyl 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate (PubChem CID 58850124) has the molecular formula C28H43N3O4S and a molecular weight of 517.74 g/mol. Its IUPAC name is [(2R,6R)-1-(benzenesulfonyl)-6-methylpiperidin-2-yl]methyl 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate.
| Compound Name | [(2R,6R)-1-(benzenesulfonyl)-6-methylpiperidin-2-yl]methyl 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58850124 |
| Molecular Formula | C28H43N3O4S |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | [(2R,6R)-1-(benzenesulfonyl)-6-methylpiperidin-2-yl]methyl 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate |
| SMILES | C[C@@H]1CCC[C@H](COC(=O)N2CCC(N3CCC4CCCCC4C3)CC2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H43N3O4S/c1-22-8-7-11-26(31(22)36(33,34)27-12-3-2-4-13-27)21-35-28(32)29-18-15-25(16-19-29)30-17-14-23-9-5-6-10-24(23)20-30/h2-4,12-13,22-26H,5-11,14-21H2,1H3/t22-,23?,24?,26-/m1/s1 |
| InChIKey | KGIPWFYPWVAPSM-BVUDCHSKSA-N |
| XLogP | 4.73 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |