C27H34N4O3 — CID 58851379
ethyl 3-[3-tert-butyl-5-(cyclohexylcarbamoylamino)pyrazol-1-yl]naphthalene-1-carboxylate (PubChem CID 58851379) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethyl 3-[3-tert-butyl-5-(cyclohexylcarbamoylamino)pyrazol-1-yl]naphthalene-1-carboxylate.
| Compound Name | ethyl 3-[3-tert-butyl-5-(cyclohexylcarbamoylamino)pyrazol-1-yl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 58851379 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | ethyl 3-[3-tert-butyl-5-(cyclohexylcarbamoylamino)pyrazol-1-yl]naphthalene-1-carboxylate |
| SMILES | CCOC(=O)c1cc(-n2nc(C(C)(C)C)cc2NC(=O)NC2CCCCC2)cc2ccccc12 |
| InChI | InChI=1S/C27H34N4O3/c1-5-34-25(32)22-16-20(15-18-11-9-10-14-21(18)22)31-24(17-23(30-31)27(2,3)4)29-26(33)28-19-12-7-6-8-13-19/h9-11,14-17,19H,5-8,12-13H2,1-4H3,(H2,28,29,33) |
| InChIKey | WZPOFWRNSJLZGU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |