C8H12INO — CID 58853085
N-[(1S,2E)-2-(iodomethylidene)-1-methylcyclobutyl]acetamide (PubChem CID 58853085) has the molecular formula C8H12INO and a molecular weight of 265.09 g/mol. Its IUPAC name is N-[(1S,2E)-2-(iodomethylidene)-1-methylcyclobutyl]acetamide.
| Compound Name | N-[(1S,2E)-2-(iodomethylidene)-1-methylcyclobutyl]acetamide |
|---|---|
| PubChem CID | 58853085 |
| Molecular Formula | C8H12INO |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | N-[(1S,2E)-2-(iodomethylidene)-1-methylcyclobutyl]acetamide |
| SMILES | CC(=O)N[C@@]1(C)CC/C1=C\I |
| InChI | InChI=1S/C8H12INO/c1-6(11)10-8(2)4-3-7(8)5-9/h5H,3-4H2,1-2H3,(H,10,11)/b7-5+/t8-/m0/s1 |
| InChIKey | VMLYMBDJSONGHJ-IVGLGHLBSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|