C12H9FO4 — CID 58859533
1-(6-fluoro-4-oxo-2,3-dihydrochromen-3-yl)propane-1,2-dione (PubChem CID 58859533) has the molecular formula C12H9FO4 and a molecular weight of 236.20 g/mol. Its IUPAC name is 1-(6-fluoro-4-oxo-2,3-dihydrochromen-3-yl)propane-1,2-dione.
| Compound Name | 1-(6-fluoro-4-oxo-2,3-dihydrochromen-3-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 58859533 |
| Molecular Formula | C12H9FO4 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(6-fluoro-4-oxo-2,3-dihydrochromen-3-yl)propane-1,2-dione |
| SMILES | CC(=O)C(=O)C1COc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C12H9FO4/c1-6(14)11(15)9-5-17-10-3-2-7(13)4-8(10)12(9)16/h2-4,9H,5H2,1H3 |
| InChIKey | ALNNXCOWWZYCLK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|