C17H25N5O3 — CID 58861104
N-hydroxy-N'-[4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]phenyl]methanimidamide (PubChem CID 58861104) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-hydroxy-N'-[4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]phenyl]methanimidamide.
| Compound Name | N-hydroxy-N'-[4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 58861104 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-hydroxy-N'-[4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]phenyl]methanimidamide |
| SMILES | O=C(CN1CCN(c2ccc(/N=C/NO)cc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N5O3/c23-17(22-9-11-25-12-10-22)13-20-5-7-21(8-6-20)16-3-1-15(2-4-16)18-14-19-24/h1-4,14,24H,5-13H2,(H,18,19) |
| InChIKey | BQSRQBICXVFESH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|