C20H20O6 — CID 58862596
methyl (4aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-2,9-dioxophenanthrene-3-carboxylate (PubChem CID 58862596) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is methyl (4aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-2,9-dioxophenanthrene-3-carboxylate.
| Compound Name | methyl (4aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-2,9-dioxophenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 58862596 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl (4aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-2,9-dioxophenanthrene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@]2(C)C(=C(O)C(=O)c3ccc(OC)cc32)C(C)(C)C1=O |
| InChI | InChI=1S/C20H20O6/c1-19(2)16-15(22)14(21)11-7-6-10(25-4)8-13(11)20(16,3)9-12(17(19)23)18(24)26-5/h6-9,22H,1-5H3/t20-/m0/s1 |
| InChIKey | BIIWDFFHNLYAQB-FQEVSTJZSA-N |
| XLogP | 2.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|