C50H52N2O11 — CID 58862655
5-[4-carboxy-3-(methylcarbamoyl)benzoyl]-2-[[4-[6-[4-(4-hexoxyphenyl)phenoxy]hexoxycarbonyl]-3-methylphenyl]carbamoyl]benzoic acid (PubChem CID 58862655) has the molecular formula C50H52N2O11 and a molecular weight of 856.97 g/mol. Its IUPAC name is 5-[4-carboxy-3-(methylcarbamoyl)benzoyl]-2-[[4-[6-[4-(4-hexoxyphenyl)phenoxy]hexoxycarbonyl]-3-methylphenyl]carbamoyl]benzoic acid.
| Compound Name | 5-[4-carboxy-3-(methylcarbamoyl)benzoyl]-2-[[4-[6-[4-(4-hexoxyphenyl)phenoxy]hexoxycarbonyl]-3-methylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 58862655 |
| Molecular Formula | C50H52N2O11 |
| Molecular Weight | 856.97 g/mol |
| Exact Mass | 856.36 |
| IUPAC Name | 5-[4-carboxy-3-(methylcarbamoyl)benzoyl]-2-[[4-[6-[4-(4-hexoxyphenyl)phenoxy]hexoxycarbonyl]-3-methylphenyl]carbamoyl]benzoic acid |
| SMILES | CCCCCCOc1ccc(-c2ccc(OCCCCCCOC(=O)c3ccc(NC(=O)c4ccc(C(=O)c5ccc(C(=O)O)c(C(=O)NC)c5)cc4C(=O)O)cc3C)cc2)cc1 |
| InChI | InChI=1S/C50H52N2O11/c1-4-5-6-9-26-61-38-19-12-33(13-20-38)34-14-21-39(22-15-34)62-27-10-7-8-11-28-63-50(60)40-25-18-37(29-32(40)2)52-47(55)41-23-16-36(31-44(41)49(58)59)45(53)35-17-24-42(48(56)57)43(30-35)46(54)51-3/h12-25,29-31H,4-11,26-28H2,1-3H3,(H,51,54)(H,52,55)(H,56,57)(H,58,59) |
| InChIKey | NKMBJJBQEDBBNM-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 194.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.97 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|