C24H24FNO4 — CID 58863604
[4-fluoro-1-[(E)-3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone (PubChem CID 58863604) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is [4-fluoro-1-[(E)-3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-fluoro-1-[(E)-3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 58863604 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [4-fluoro-1-[(E)-3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(F)cn2C/C=C/c2cccc(O[C@@H](C)COO)c2)cc1 |
| InChI | InChI=1S/C24H24FNO4/c1-17-8-10-20(11-9-17)24(27)23-14-21(25)15-26(23)12-4-6-19-5-3-7-22(13-19)30-18(2)16-29-28/h3-11,13-15,18,28H,12,16H2,1-2H3/b6-4+/t18-/m0/s1 |
| InChIKey | BSTKHTITAPKSEY-JXTAAOLFSA-N |
| XLogP | 5.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|