C27H28F3NO4 — CID 91147620
[1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]-4-(trifluoromethyl)pyrrol-2-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 91147620) has the molecular formula C27H28F3NO4 and a molecular weight of 487.52 g/mol. Its IUPAC name is [1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]-4-(trifluoromethyl)pyrrol-2-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]-4-(trifluoromethyl)pyrrol-2-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 91147620 |
| Molecular Formula | C27H28F3NO4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]-4-(trifluoromethyl)pyrrol-2-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1ccc(C(=O)c2cc(C(F)(F)F)cn2CC=Cc2cccc(O[C@@H](C)COO)c2)cc1 |
| InChI | InChI=1S/C27H28F3NO4/c1-18(2)21-9-11-22(12-10-21)26(32)25-15-23(27(28,29)30)16-31(25)13-5-7-20-6-4-8-24(14-20)35-19(3)17-34-33/h4-12,14-16,18-19,33H,13,17H2,1-3H3/t19-/m0/s1 |
| InChIKey | IHJSQDYKYCYZBU-IBGZPJMESA-N |
| XLogP | 6.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|