C24H22ClNO6 — CID 91416130
1,3-benzodioxol-5-yl-[4-chloro-1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]methanone (PubChem CID 91416130) has the molecular formula C24H22ClNO6 and a molecular weight of 455.89 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-chloro-1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-chloro-1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 91416130 |
| Molecular Formula | C24H22ClNO6 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-chloro-1-[3-[3-[(2S)-1-hydroperoxypropan-2-yl]oxyphenyl]prop-2-enyl]pyrrol-2-yl]methanone |
| SMILES | C[C@@H](COO)Oc1cccc(C=CCn2cc(Cl)cc2C(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H22ClNO6/c1-16(14-31-28)32-20-6-2-4-17(10-20)5-3-9-26-13-19(25)12-21(26)24(27)18-7-8-22-23(11-18)30-15-29-22/h2-8,10-13,16,28H,9,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | XRRQKZHPVIDKBK-INIZCTEOSA-N |
| XLogP | 5.07 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|