C28H30ClNO5 — CID 110177160
[(E)-4-(1,3-benzodioxol-5-yl)-5-(3-methoxyphenyl)-3-oxopent-4-enyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110177160) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is [(E)-4-(1,3-benzodioxol-5-yl)-5-(3-methoxyphenyl)-3-oxopent-4-enyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | [(E)-4-(1,3-benzodioxol-5-yl)-5-(3-methoxyphenyl)-3-oxopent-4-enyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110177160 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [(E)-4-(1,3-benzodioxol-5-yl)-5-(3-methoxyphenyl)-3-oxopent-4-enyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | COc1cccc(/C=C(/C(=O)CC[NH2+]C(C)C(O)c2ccccc2)c2ccc3c(c2)OCO3)c1.[Cl-] |
| InChI | InChI=1S/C28H29NO5.ClH/c1-19(28(31)21-8-4-3-5-9-21)29-14-13-25(30)24(16-20-7-6-10-23(15-20)32-2)22-11-12-26-27(17-22)34-18-33-26;/h3-12,15-17,19,28-29,31H,13-14,18H2,1-2H3;1H/b24-16+; |
| InChIKey | FJIUTIOCOPJXGR-RSOFWHLMSA-N |
| XLogP | 0.61 |
| TPSA | 81.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|