C20H21NO8 — CID 58863935
2-[(4-carboxyphenyl)methoxy]-6-[5-(hydroxyamino)-5-oxopentoxy]benzoic acid (PubChem CID 58863935) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-[(4-carboxyphenyl)methoxy]-6-[5-(hydroxyamino)-5-oxopentoxy]benzoic acid.
| Compound Name | 2-[(4-carboxyphenyl)methoxy]-6-[5-(hydroxyamino)-5-oxopentoxy]benzoic acid |
|---|---|
| PubChem CID | 58863935 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[(4-carboxyphenyl)methoxy]-6-[5-(hydroxyamino)-5-oxopentoxy]benzoic acid |
| SMILES | O=C(CCCCOc1cccc(OCc2ccc(C(=O)O)cc2)c1C(=O)O)NO |
| InChI | InChI=1S/C20H21NO8/c22-17(21-27)6-1-2-11-28-15-4-3-5-16(18(15)20(25)26)29-12-13-7-9-14(10-8-13)19(23)24/h3-5,7-10,27H,1-2,6,11-12H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | YYLDCNWVTMULGI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|