C28H29N3O2S — CID 58872164
N'-cyclohexyl-6-(2-methoxyphenyl)-N'-methylbenzo[b][1,4]benzothiazepine-3-carbohydrazide (PubChem CID 58872164) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is N'-cyclohexyl-6-(2-methoxyphenyl)-N'-methylbenzo[b][1,4]benzothiazepine-3-carbohydrazide.
| Compound Name | N'-cyclohexyl-6-(2-methoxyphenyl)-N'-methylbenzo[b][1,4]benzothiazepine-3-carbohydrazide |
|---|---|
| PubChem CID | 58872164 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N'-cyclohexyl-6-(2-methoxyphenyl)-N'-methylbenzo[b][1,4]benzothiazepine-3-carbohydrazide |
| SMILES | COc1ccccc1C1=Nc2cc(C(=O)NN(C)C3CCCCC3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H29N3O2S/c1-31(20-10-4-3-5-11-20)30-28(32)19-16-17-26-23(18-19)29-27(21-12-6-8-14-24(21)33-2)22-13-7-9-15-25(22)34-26/h6-9,12-18,20H,3-5,10-11H2,1-2H3,(H,30,32) |
| InChIKey | JJJGBGJVDOAHQF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|