C9H21N3O2S — CID 58874312
N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]ethanesulfonamide (PubChem CID 58874312) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]ethanesulfonamide.
| Compound Name | N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 58874312 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1CC[C@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C9H21N3O2S/c1-2-15(13,14)12-6-7-3-4-8(10)9(11)5-7/h7-9,12H,2-6,10-11H2,1H3/t7?,8-,9+/m0/s1 |
| InChIKey | HRENTSNYKWIRDZ-SXNZSPLWSA-N |
| XLogP | -0.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |