C35H46N4O4S — CID 58874666
N-[3-(benzenesulfonamido)-1-cyclohexyl-3-oxopropyl]-3-(benzylamino)-4-[methyl(3-methylbutyl)amino]benzamide (PubChem CID 58874666) has the molecular formula C35H46N4O4S and a molecular weight of 618.84 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-1-cyclohexyl-3-oxopropyl]-3-(benzylamino)-4-[methyl(3-methylbutyl)amino]benzamide.
| Compound Name | N-[3-(benzenesulfonamido)-1-cyclohexyl-3-oxopropyl]-3-(benzylamino)-4-[methyl(3-methylbutyl)amino]benzamide |
|---|---|
| PubChem CID | 58874666 |
| Molecular Formula | C35H46N4O4S |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | N-[3-(benzenesulfonamido)-1-cyclohexyl-3-oxopropyl]-3-(benzylamino)-4-[methyl(3-methylbutyl)amino]benzamide |
| SMILES | CC(C)CCN(C)c1ccc(C(=O)NC(CC(=O)NS(=O)(=O)c2ccccc2)C2CCCCC2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C35H46N4O4S/c1-26(2)21-22-39(3)33-20-19-29(23-32(33)36-25-27-13-7-4-8-14-27)35(41)37-31(28-15-9-5-10-16-28)24-34(40)38-44(42,43)30-17-11-6-12-18-30/h4,6-8,11-14,17-20,23,26,28,31,36H,5,9-10,15-16,21-22,24-25H2,1-3H3,(H,37,41)(H,38,40) |
| InChIKey | MBAOTUNSXRDQIB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |