C33H46N6O4S — CID 58874922
3-(benzylamino)-N-[1-cyclohexyl-3-[(1-methylimidazol-4-yl)sulfonylamino]-3-oxopropyl]-4-[methyl(3-methylbutyl)amino]benzamide (PubChem CID 58874922) has the molecular formula C33H46N6O4S and a molecular weight of 622.84 g/mol. Its IUPAC name is 3-(benzylamino)-N-[1-cyclohexyl-3-[(1-methylimidazol-4-yl)sulfonylamino]-3-oxopropyl]-4-[methyl(3-methylbutyl)amino]benzamide.
| Compound Name | 3-(benzylamino)-N-[1-cyclohexyl-3-[(1-methylimidazol-4-yl)sulfonylamino]-3-oxopropyl]-4-[methyl(3-methylbutyl)amino]benzamide |
|---|---|
| PubChem CID | 58874922 |
| Molecular Formula | C33H46N6O4S |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 3-(benzylamino)-N-[1-cyclohexyl-3-[(1-methylimidazol-4-yl)sulfonylamino]-3-oxopropyl]-4-[methyl(3-methylbutyl)amino]benzamide |
| SMILES | CC(C)CCN(C)c1ccc(C(=O)NC(CC(=O)NS(=O)(=O)c2cn(C)cn2)C2CCCCC2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C33H46N6O4S/c1-24(2)17-18-39(4)30-16-15-27(19-29(30)34-21-25-11-7-5-8-12-25)33(41)36-28(26-13-9-6-10-14-26)20-31(40)37-44(42,43)32-22-38(3)23-35-32/h5,7-8,11-12,15-16,19,22-24,26,28,34H,6,9-10,13-14,17-18,20-21H2,1-4H3,(H,36,41)(H,37,40) |
| InChIKey | BDYKIAJJARYUNB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |