About 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide
2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 58878121) has the molecular formula C6H7BrN2OS
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 58878121 |
| Molecular Formula | C6H7BrN2OS |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)CBr)s1 |
| InChI | InChI=1S/C6H7BrN2OS/c1-4-3-8-6(11-4)9-5(10)2-7/h3H,2H2,1H3,(H,8,9,10) |
| InChIKey | YHHHSVCNXIXDNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide (CID 58878121) is 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide is Cc1cnc(NC(=O)CBr)s1.
What is the InChIKey of 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is YHHHSVCNXIXDNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2OS/c1-4-3-8-6(11-4)9-5(10)2-7/h3H,2H2,1H3,(H,8,9,10).
What are the key properties of 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide?
2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 235.11 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 58878121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).