C7H5F5N2OS — CID 17386520
2,2,3,3,3-pentafluoro-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 17386520) has the molecular formula C7H5F5N2OS and a molecular weight of 260.19 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 17386520 |
| Molecular Formula | C7H5F5N2OS |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H5F5N2OS/c1-3-2-13-5(16-3)14-4(15)6(8,9)7(10,11)12/h2H,1H3,(H,13,14,15) |
| InChIKey | WBFZQHZKXFSYIK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|