C23H21NO3S — CID 58883559
N-[2-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)phenyl]benzenesulfonamide (PubChem CID 58883559) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[2-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58883559 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[2-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1ccccc1NS(=O)(=O)c1ccccc1)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C23H21NO3S/c25-23(20-15-8-10-17-9-4-5-13-19(17)20)21-14-6-7-16-22(21)24-28(26,27)18-11-2-1-3-12-18/h1-3,6-8,10-12,14-16,24H,4-5,9,13H2 |
| InChIKey | WEKODYHYJQSITB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|