C22H20N2O3S — CID 70880021
N-[2-(1,2,3,4-tetrahydroisoquinoline-5-carbonyl)phenyl]benzenesulfonamide (PubChem CID 70880021) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[2-(1,2,3,4-tetrahydroisoquinoline-5-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(1,2,3,4-tetrahydroisoquinoline-5-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70880021 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[2-(1,2,3,4-tetrahydroisoquinoline-5-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1ccccc1NS(=O)(=O)c1ccccc1)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C22H20N2O3S/c25-22(19-11-6-7-16-15-23-14-13-18(16)19)20-10-4-5-12-21(20)24-28(26,27)17-8-2-1-3-9-17/h1-12,23-24H,13-15H2 |
| InChIKey | RZJZRRXVUFIXEV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|