About phenylmethoxymethyl carbamimidoselenoate
phenylmethoxymethyl carbamimidoselenoate (PubChem CID 58884129) has the molecular formula C9H12N2OSe
and a molecular weight of 243.17 g/mol. Its IUPAC name is phenylmethoxymethyl carbamimidoselenoate.
Molecular Properties
| Compound Name | phenylmethoxymethyl carbamimidoselenoate |
| PubChem CID | 58884129 |
| Molecular Formula | C9H12N2OSe |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | phenylmethoxymethyl carbamimidoselenoate |
| SMILES | [H]/N=C(\N)[Se]COCc1ccccc1 |
| InChI | InChI=1S/C9H12N2OSe/c10-9(11)13-7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,10,11) |
| InChIKey | FOYSPVMZIHBJGH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenylmethoxymethyl carbamimidoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxymethyl carbamimidoselenoate?
The IUPAC name of phenylmethoxymethyl carbamimidoselenoate (CID 58884129) is phenylmethoxymethyl carbamimidoselenoate.
What is the SMILES notation for phenylmethoxymethyl carbamimidoselenoate?
The canonical SMILES for phenylmethoxymethyl carbamimidoselenoate is [H]/N=C(\N)[Se]COCc1ccccc1.
What is the InChIKey of phenylmethoxymethyl carbamimidoselenoate?
The InChIKey is FOYSPVMZIHBJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OSe/c10-9(11)13-7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,10,11).
What are the key properties of phenylmethoxymethyl carbamimidoselenoate?
phenylmethoxymethyl carbamimidoselenoate has a molecular weight of 243.17 g/mol, XLogP of 0.76, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxymethyl carbamimidoselenoate is sourced from PubChem (CID 58884129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).