C14H13BrN4S — CID 58891355
5-bromo-2-N-(3-methylsulfanylphenyl)-4-N-prop-2-ynylpyrimidine-2,4-diamine (PubChem CID 58891355) has the molecular formula C14H13BrN4S and a molecular weight of 349.26 g/mol. Its IUPAC name is 5-bromo-2-N-(3-methylsulfanylphenyl)-4-N-prop-2-ynylpyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-(3-methylsulfanylphenyl)-4-N-prop-2-ynylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58891355 |
| Molecular Formula | C14H13BrN4S |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 5-bromo-2-N-(3-methylsulfanylphenyl)-4-N-prop-2-ynylpyrimidine-2,4-diamine |
| SMILES | C#CCNc1nc(Nc2cccc(SC)c2)ncc1Br |
| InChI | InChI=1S/C14H13BrN4S/c1-3-7-16-13-12(15)9-17-14(19-13)18-10-5-4-6-11(8-10)20-2/h1,4-6,8-9H,7H2,2H3,(H2,16,17,18,19) |
| InChIKey | QHBZBEHTUZGOID-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|