C49H53BN2O7 — CID 58892933
CID 58892933 (PubChem CID 58892933) has the molecular formula C49H53BN2O7 and a molecular weight of 792.78 g/mol.
| Compound Name | CID 58892933 |
|---|---|
| PubChem CID | 58892933 |
| Molecular Formula | C49H53BN2O7 |
| Molecular Weight | 792.78 g/mol |
| Exact Mass | 792.39 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H](CCCC)C(=O)N(C)[C@@H](Cc1cc(-c2ccc(OCc3ccccc3)c(C[C@H](C)C(C)=O)c2)ccc1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C49H53BN2O7/c1-5-6-22-43(51-49(50)56)47(54)52(4)44(48(55)59-33-38-20-14-9-15-21-38)30-42-29-40(24-26-46(42)58-32-37-18-12-8-13-19-37)39-23-25-45(41(28-39)27-34(2)35(3)53)57-31-36-16-10-7-11-17-36/h7-21,23-26,28-29,34,43-44H,5-6,22,27,30-33H2,1-4H3,(H,51,56)/t34-,43-,44-/m0/s1 |
| InChIKey | RZSYBOHJTXMNPK-COPCYUSGSA-N |
| XLogP | 8.83 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.78 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|